C15H15BrCl2N2O — CID 105295115
[1-(3-bromo-4-methoxyphenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine (PubChem CID 105295115) has the molecular formula C15H15BrCl2N2O and a molecular weight of 390.11 g/mol. Its IUPAC name is [1-(3-bromo-4-methoxyphenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-4-methoxyphenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105295115 |
| Molecular Formula | C15H15BrCl2N2O |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | [1-(3-bromo-4-methoxyphenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(Cc2ccc(Cl)cc2Cl)NN)cc1Br |
| InChI | InChI=1S/C15H15BrCl2N2O/c1-21-15-5-3-10(6-12(15)16)14(20-19)7-9-2-4-11(17)8-13(9)18/h2-6,8,14,20H,7,19H2,1H3 |
| InChIKey | WDMHWMAHVHRJCK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|