C16H18Cl2N2O — CID 105200111
[2-(2,4-dichlorophenyl)-1-(4-ethoxyphenyl)ethyl]hydrazine (PubChem CID 105200111) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-1-(4-ethoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-(2,4-dichlorophenyl)-1-(4-ethoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105200111 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-1-(4-ethoxyphenyl)ethyl]hydrazine |
| SMILES | CCOc1ccc(C(Cc2ccc(Cl)cc2Cl)NN)cc1 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-21-14-7-4-11(5-8-14)16(20-19)9-12-3-6-13(17)10-15(12)18/h3-8,10,16,20H,2,9,19H2,1H3 |
| InChIKey | UCBFNYGFUFNEFK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|