C10H14F2N2 — CID 102869089
1,1-difluoro-N-(2-pyridin-4-ylethyl)propan-2-amine (PubChem CID 102869089) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,1-difluoro-N-(2-pyridin-4-ylethyl)propan-2-amine.
| Compound Name | 1,1-difluoro-N-(2-pyridin-4-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 102869089 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1,1-difluoro-N-(2-pyridin-4-ylethyl)propan-2-amine |
| SMILES | CC(NCCc1ccncc1)C(F)F |
| InChI | InChI=1S/C10H14F2N2/c1-8(10(11)12)14-7-4-9-2-5-13-6-3-9/h2-3,5-6,8,10,14H,4,7H2,1H3 |
| InChIKey | XLCHYLVNJABKFF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |