C13H20N2O2 — CID 79392378
methyl 2-methyl-3-(2-pyridin-4-ylethylamino)butanoate (PubChem CID 79392378) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl 2-methyl-3-(2-pyridin-4-ylethylamino)butanoate.
| Compound Name | methyl 2-methyl-3-(2-pyridin-4-ylethylamino)butanoate |
|---|---|
| PubChem CID | 79392378 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | methyl 2-methyl-3-(2-pyridin-4-ylethylamino)butanoate |
| SMILES | COC(=O)C(C)C(C)NCCc1ccncc1 |
| InChI | InChI=1S/C13H20N2O2/c1-10(13(16)17-3)11(2)15-9-6-12-4-7-14-8-5-12/h4-5,7-8,10-11,15H,6,9H2,1-3H3 |
| InChIKey | RCUWKGYFQNQDCC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |