About N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine
N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine (PubChem CID 102869961) has the molecular formula C10H20F2N2
and a molecular weight of 206.28 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine.
Molecular Properties
| Compound Name | N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine |
| PubChem CID | 102869961 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine |
| SMILES | CC(NN1C(C)CCCC1C)C(F)F |
| InChI | InChI=1S/C10H20F2N2/c1-7-5-4-6-8(2)14(7)13-9(3)10(11)12/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | XPHZCNKPHSNBCT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine?
The IUPAC name of N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine (CID 102869961) is N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine.
What is the SMILES notation for N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine?
The canonical SMILES for N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine is CC(NN1C(C)CCCC1C)C(F)F.
What is the InChIKey of N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine?
The InChIKey is XPHZCNKPHSNBCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2N2/c1-7-5-4-6-8(2)14(7)13-9(3)10(11)12/h7-10,13H,4-6H2,1-3H3.
What are the key properties of N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine?
N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine has a molecular weight of 206.28 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-difluoropropan-2-yl)-2,6-dimethylpiperidin-1-amine is sourced from PubChem (CID 102869961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).