C10H19F2NO — CID 102869994
2-(1,1-difluoropropan-2-ylamino)cycloheptan-1-ol (PubChem CID 102869994) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(1,1-difluoropropan-2-ylamino)cycloheptan-1-ol.
| Compound Name | 2-(1,1-difluoropropan-2-ylamino)cycloheptan-1-ol |
|---|---|
| PubChem CID | 102869994 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-(1,1-difluoropropan-2-ylamino)cycloheptan-1-ol |
| SMILES | CC(NC1CCCCCC1O)C(F)F |
| InChI | InChI=1S/C10H19F2NO/c1-7(10(11)12)13-8-5-3-2-4-6-9(8)14/h7-10,13-14H,2-6H2,1H3 |
| InChIKey | NOXZESUXXOSAPM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |