About cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol
cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol (PubChem CID 124709342) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol |
| PubChem CID | 124709342 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC[C@H](C)[C@H](C)N[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H25NO/c1-4-9(2)10(3)13-11-7-5-6-8-12(11)14/h9-14H,4-8H2,1-3H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | JCLVWJRVXOQGIT-FIQHERPVSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol?
The IUPAC name of cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol (CID 124709342) is cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol?
The canonical SMILES for cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol is CC[C@H](C)[C@H](C)N[C@H]1CCCC[C@H]1O.
What is the InChIKey of cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol?
The InChIKey is JCLVWJRVXOQGIT-FIQHERPVSA-N. The full InChI is InChI=1S/C12H25NO/c1-4-9(2)10(3)13-11-7-5-6-8-12(11)14/h9-14H,4-8H2,1-3H3/t9-,10-,11-,12+/m0/s1.
What are the key properties of cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol?
cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol has a molecular weight of 199.34 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[[(2S,3S)-3-methylpentan-2-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 124709342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).