C9H16F2N2O — CID 102870007
N-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)propanamide (PubChem CID 102870007) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is N-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)propanamide.
| Compound Name | N-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 102870007 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)propanamide |
| SMILES | CC(NC(C)C(F)F)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H16F2N2O/c1-5(8(10)11)12-6(2)9(14)13-7-3-4-7/h5-8,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | UVYCEAQEUFBGIO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |