C6H13F2NOS — CID 102870071
1,1-difluoro-N-(2-methylsulfinylethyl)propan-2-amine (PubChem CID 102870071) has the molecular formula C6H13F2NOS and a molecular weight of 185.24 g/mol. Its IUPAC name is 1,1-difluoro-N-(2-methylsulfinylethyl)propan-2-amine.
| Compound Name | 1,1-difluoro-N-(2-methylsulfinylethyl)propan-2-amine |
|---|---|
| PubChem CID | 102870071 |
| Molecular Formula | C6H13F2NOS |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1,1-difluoro-N-(2-methylsulfinylethyl)propan-2-amine |
| SMILES | CC(NCCS(C)=O)C(F)F |
| InChI | InChI=1S/C6H13F2NOS/c1-5(6(7)8)9-3-4-11(2)10/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | GWMCIWFAKBHKLH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |