C8H17F2NO — CID 102870095
1-(1,1-difluoropropan-2-ylamino)-3-methylbutan-2-ol (PubChem CID 102870095) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(1,1-difluoropropan-2-ylamino)-3-methylbutan-2-ol.
| Compound Name | 1-(1,1-difluoropropan-2-ylamino)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 102870095 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(1,1-difluoropropan-2-ylamino)-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)CNC(C)C(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-5(2)7(12)4-11-6(3)8(9)10/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | KNNXHONUUQQVET-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |