C10H20F3NO — CID 146647597
(3S)-2-(4,4,4-trifluorobutylamino)hexan-3-ol (PubChem CID 146647597) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is (3S)-2-(4,4,4-trifluorobutylamino)hexan-3-ol.
| Compound Name | (3S)-2-(4,4,4-trifluorobutylamino)hexan-3-ol |
|---|---|
| PubChem CID | 146647597 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (3S)-2-(4,4,4-trifluorobutylamino)hexan-3-ol |
| SMILES | CCC[C@H](O)C(C)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO/c1-3-5-9(15)8(2)14-7-4-6-10(11,12)13/h8-9,14-15H,3-7H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | HLGCLVPIYZADFI-GKAPJAKFSA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|