C16H25FN2O — CID 102870739
3-[[3-amino-3-(2-fluorophenyl)propyl]-cyclobutylamino]propan-1-ol (PubChem CID 102870739) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[[3-amino-3-(2-fluorophenyl)propyl]-cyclobutylamino]propan-1-ol.
| Compound Name | 3-[[3-amino-3-(2-fluorophenyl)propyl]-cyclobutylamino]propan-1-ol |
|---|---|
| PubChem CID | 102870739 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3-[[3-amino-3-(2-fluorophenyl)propyl]-cyclobutylamino]propan-1-ol |
| SMILES | NC(CCN(CCCO)C1CCC1)c1ccccc1F |
| InChI | InChI=1S/C16H25FN2O/c17-15-8-2-1-7-14(15)16(18)9-11-19(10-4-12-20)13-5-3-6-13/h1-2,7-8,13,16,20H,3-6,9-12,18H2 |
| InChIKey | ASGOQRGJYGAUKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |