C16H25FN2O — CID 102871056
2-[[3-amino-3-(3-fluoro-4-methylphenyl)propyl]-cyclobutylamino]ethanol (PubChem CID 102871056) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[[3-amino-3-(3-fluoro-4-methylphenyl)propyl]-cyclobutylamino]ethanol.
| Compound Name | 2-[[3-amino-3-(3-fluoro-4-methylphenyl)propyl]-cyclobutylamino]ethanol |
|---|---|
| PubChem CID | 102871056 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[[3-amino-3-(3-fluoro-4-methylphenyl)propyl]-cyclobutylamino]ethanol |
| SMILES | Cc1ccc(C(N)CCN(CCO)C2CCC2)cc1F |
| InChI | InChI=1S/C16H25FN2O/c1-12-5-6-13(11-15(12)17)16(18)7-8-19(9-10-20)14-3-2-4-14/h5-6,11,14,16,20H,2-4,7-10,18H2,1H3 |
| InChIKey | PSXRZRWYFJTRRO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |