C16H18ClNO3S2 — CID 10287096
3-chloro-2-methyl-N-[4-(2-oxopentyl)thiophen-3-yl]benzenesulfonamide (PubChem CID 10287096) has the molecular formula C16H18ClNO3S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[4-(2-oxopentyl)thiophen-3-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[4-(2-oxopentyl)thiophen-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10287096 |
| Molecular Formula | C16H18ClNO3S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-chloro-2-methyl-N-[4-(2-oxopentyl)thiophen-3-yl]benzenesulfonamide |
| SMILES | CCCC(=O)Cc1cscc1NS(=O)(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C16H18ClNO3S2/c1-3-5-13(19)8-12-9-22-10-15(12)18-23(20,21)16-7-4-6-14(17)11(16)2/h4,6-7,9-10,18H,3,5,8H2,1-2H3 |
| InChIKey | DJBWHBNYYIXXCX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |