C17H15Cl2NO3S — CID 143906895
3-chloro-N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-2-methylbenzenesulfonamide (PubChem CID 143906895) has the molecular formula C17H15Cl2NO3S and a molecular weight of 384.28 g/mol. Its IUPAC name is 3-chloro-N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143906895 |
| Molecular Formula | C17H15Cl2NO3S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 3-chloro-N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-2-methylbenzenesulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)c2cccc(Cl)c2C)cc(Cl)c(O)c1C=C |
| InChI | InChI=1S/C17H15Cl2NO3S/c1-4-11-12(5-2)17(21)14(19)9-15(11)20-24(22,23)16-8-6-7-13(18)10(16)3/h4-9,20-21H,1-2H2,3H3 |
| InChIKey | WQYXIVXQJDSQFZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|