C17H16N2O5S — CID 144779179
N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-2-methyl-5-nitrosobenzenesulfonamide (PubChem CID 144779179) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-2-methyl-5-nitrosobenzenesulfonamide.
| Compound Name | N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-2-methyl-5-nitrosobenzenesulfonamide |
|---|---|
| PubChem CID | 144779179 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-2-methyl-5-nitrosobenzenesulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)c2cc(N=O)ccc2C)cc(O)c(O)c1C=C |
| InChI | InChI=1S/C17H16N2O5S/c1-4-12-13(5-2)17(21)15(20)9-14(12)19-25(23,24)16-8-11(18-22)7-6-10(16)3/h4-9,19-21H,1-2H2,3H3 |
| InChIKey | LFUCGQMYQLIXET-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|