C16H16ClN3O5S — CID 156749782
N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 156749782) has the molecular formula C16H16ClN3O5S and a molecular weight of 397.84 g/mol. Its IUPAC name is N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 156749782 |
| Molecular Formula | C16H16ClN3O5S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-[5-chloro-2,3-bis(ethenyl)-4-hydroxyphenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)cc(Cl)c(O)c1C=C |
| InChI | InChI=1S/C16H16ClN3O5S/c1-5-9-10(6-2)14(21)11(17)7-12(9)18-26(24,25)13-8-19(3)16(23)20(4)15(13)22/h5-8,18,21H,1-2H2,3-4H3 |
| InChIKey | ZCXZDKVEOCCCLS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|