C17H19N3O6S — CID 144778812
N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-1-ethyl-3-methyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 144778812) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-1-ethyl-3-methyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-1-ethyl-3-methyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 144778812 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[2,3-bis(ethenyl)-4,5-dihydroxyphenyl]-1-ethyl-3-methyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)c2cn(CC)c(=O)n(C)c2=O)cc(O)c(O)c1C=C |
| InChI | InChI=1S/C17H19N3O6S/c1-5-10-11(6-2)15(22)13(21)8-12(10)18-27(25,26)14-9-20(7-3)17(24)19(4)16(14)23/h5-6,8-9,18,21-22H,1-2,7H2,3-4H3 |
| InChIKey | LQMKHQWHYKWLLS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|