C11H11ClN4O4S — CID 103604457
N-(2-chloro-3-pyridinyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 103604457) has the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 103604457 |
| Molecular Formula | C11H11ClN4O4S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2cccnc2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H11ClN4O4S/c1-15-6-8(10(17)16(2)11(15)18)21(19,20)14-7-4-3-5-13-9(7)12/h3-6,14H,1-2H3 |
| InChIKey | UYXCETVZJDMXLE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|