C11H10ClN3O4S — CID 43245095
4-[(2-chloro-3-pyridinyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 43245095) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-chloro-3-pyridinyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43245095 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(S(=O)(=O)Nc2cccnc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H10ClN3O4S/c1-15-6-7(5-9(15)11(16)17)20(18,19)14-8-3-2-4-13-10(8)12/h2-6,14H,1H3,(H,16,17) |
| InChIKey | NUADTMRRRJUMBQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|