C12H13BrN4O3S — CID 103816029
4-[(2-bromo-3-pyridinyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 103816029) has the molecular formula C12H13BrN4O3S and a molecular weight of 373.23 g/mol. Its IUPAC name is 4-[(2-bromo-3-pyridinyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | 4-[(2-bromo-3-pyridinyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103816029 |
| Molecular Formula | C12H13BrN4O3S |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 4-[(2-bromo-3-pyridinyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)Nc2cccnc2Br)cn1C |
| InChI | InChI=1S/C12H13BrN4O3S/c1-14-12(18)10-6-8(7-17(10)2)21(19,20)16-9-4-3-5-15-11(9)13/h3-7,16H,1-2H3,(H,14,18) |
| InChIKey | NFZLFQSCKQKINB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|