C15H13ClN2O6S — CID 18287797
dimethyl 5-[(2-chloro-3-pyridinyl)sulfamoyl]benzene-1,3-dicarboxylate (PubChem CID 18287797) has the molecular formula C15H13ClN2O6S and a molecular weight of 384.80 g/mol. Its IUPAC name is dimethyl 5-[(2-chloro-3-pyridinyl)sulfamoyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-chloro-3-pyridinyl)sulfamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18287797 |
| Molecular Formula | C15H13ClN2O6S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | dimethyl 5-[(2-chloro-3-pyridinyl)sulfamoyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)Nc2cccnc2Cl)c1 |
| InChI | InChI=1S/C15H13ClN2O6S/c1-23-14(19)9-6-10(15(20)24-2)8-11(7-9)25(21,22)18-12-4-3-5-17-13(12)16/h3-8,18H,1-2H3 |
| InChIKey | AAYSWUNPANAVRX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|