C12H12BrN3O4S — CID 7475132
N-(4-bromophenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 7475132) has the molecular formula C12H12BrN3O4S and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(4-bromophenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7475132 |
| Molecular Formula | C12H12BrN3O4S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | N-(4-bromophenyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(Br)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H12BrN3O4S/c1-15-7-10(11(17)16(2)12(15)18)21(19,20)14-9-5-3-8(13)4-6-9/h3-7,14H,1-2H3 |
| InChIKey | CFCRVJIUPDAQDS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |