C12H11BrN2O5S — CID 7475358
(4-bromophenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (PubChem CID 7475358) has the molecular formula C12H11BrN2O5S and a molecular weight of 375.20 g/mol. Its IUPAC name is (4-bromophenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
| Compound Name | (4-bromophenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7475358 |
| Molecular Formula | C12H11BrN2O5S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | (4-bromophenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| SMILES | Cn1cc(S(=O)(=O)Oc2ccc(Br)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H11BrN2O5S/c1-14-7-10(11(16)15(2)12(14)17)21(18,19)20-9-5-3-8(13)4-6-9/h3-7H,1-2H3 |
| InChIKey | SXQYNFXVRSBBIU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|