C13H15FN2O2 — CID 102876748
4-[(2-fluoro-4-methoxyphenyl)methyl]morpholine-2-carbonitrile (PubChem CID 102876748) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-[(2-fluoro-4-methoxyphenyl)methyl]morpholine-2-carbonitrile.
| Compound Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 102876748 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]morpholine-2-carbonitrile |
| SMILES | COc1ccc(CN2CCOC(C#N)C2)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O2/c1-17-11-3-2-10(13(14)6-11)8-16-4-5-18-12(7-15)9-16/h2-3,6,12H,4-5,8-9H2,1H3 |
| InChIKey | MJXZUNNKYCSCRC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |