C15H22FNO3 — CID 74247681
4-[(2-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxyethyl)morpholine (PubChem CID 74247681) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 4-[(2-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxyethyl)morpholine.
| Compound Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxyethyl)morpholine |
|---|---|
| PubChem CID | 74247681 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxyethyl)morpholine |
| SMILES | COCCC1CN(Cc2ccc(OC)cc2F)CCO1 |
| InChI | InChI=1S/C15H22FNO3/c1-18-7-5-14-11-17(6-8-20-14)10-12-3-4-13(19-2)9-15(12)16/h3-4,9,14H,5-8,10-11H2,1-2H3 |
| InChIKey | PQAUKWMHVAFANM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |