C12H19NO3 — CID 131934438
4-(furan-3-ylmethyl)-2-(2-methoxyethyl)morpholine (PubChem CID 131934438) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-(furan-3-ylmethyl)-2-(2-methoxyethyl)morpholine.
| Compound Name | 4-(furan-3-ylmethyl)-2-(2-methoxyethyl)morpholine |
|---|---|
| PubChem CID | 131934438 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 4-(furan-3-ylmethyl)-2-(2-methoxyethyl)morpholine |
| SMILES | COCCC1CN(Cc2ccoc2)CCO1 |
| InChI | InChI=1S/C12H19NO3/c1-14-5-3-12-9-13(4-7-16-12)8-11-2-6-15-10-11/h2,6,10,12H,3-5,7-9H2,1H3 |
| InChIKey | IMRWDWYBBPTTTC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |