C15H23NO3 — CID 95147358
(2S)-4-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2-(2-methoxyethyl)morpholine (PubChem CID 95147358) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2S)-4-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2-(2-methoxyethyl)morpholine.
| Compound Name | (2S)-4-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2-(2-methoxyethyl)morpholine |
|---|---|
| PubChem CID | 95147358 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2S)-4-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2-(2-methoxyethyl)morpholine |
| SMILES | COCC[C@H]1CN(C/C(C)=C/c2ccco2)CCO1 |
| InChI | InChI=1S/C15H23NO3/c1-13(10-14-4-3-7-18-14)11-16-6-9-19-15(12-16)5-8-17-2/h3-4,7,10,15H,5-6,8-9,11-12H2,1-2H3/b13-10+/t15-/m0/s1 |
| InChIKey | NWAIUDVSDOLCEF-VOMSXAGXSA-N |
| XLogP | 2.42 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |