C25H25N5O — CID 10287711
1-[2-(2-azabicyclo[2.2.2]octan-2-yl)quinolin-6-yl]-3-(1H-indol-5-yl)urea (PubChem CID 10287711) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[2-(2-azabicyclo[2.2.2]octan-2-yl)quinolin-6-yl]-3-(1H-indol-5-yl)urea.
| Compound Name | 1-[2-(2-azabicyclo[2.2.2]octan-2-yl)quinolin-6-yl]-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 10287711 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[2-(2-azabicyclo[2.2.2]octan-2-yl)quinolin-6-yl]-3-(1H-indol-5-yl)urea |
| SMILES | O=C(Nc1ccc2nc(N3CC4CCC3CC4)ccc2c1)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C25H25N5O/c31-25(27-19-4-8-22-18(14-19)11-12-26-22)28-20-5-9-23-17(13-20)3-10-24(29-23)30-15-16-1-6-21(30)7-2-16/h3-5,8-14,16,21,26H,1-2,6-7,15H2,(H2,27,28,31) |
| InChIKey | FOUIVQRXHKTZTL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |