C12H21N3 — CID 102877835
N,N'-dimethyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine (PubChem CID 102877835) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 102877835 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N,N'-dimethyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine |
| SMILES | CNCCCN(C)Cc1cncc(C)c1 |
| InChI | InChI=1S/C12H21N3/c1-11-7-12(9-14-8-11)10-15(3)6-4-5-13-2/h7-9,13H,4-6,10H2,1-3H3 |
| InChIKey | HUFSKKNQSJPCJA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|