C14H21N3O — CID 102881422
(NE)-N-[3-ethyl-1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]hydroxylamine (PubChem CID 102881422) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (NE)-N-[3-ethyl-1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-ethyl-1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 102881422 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (NE)-N-[3-ethyl-1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]hydroxylamine |
| SMILES | CCC1CN(Cc2cncc(C)c2)CC/C1=N\O |
| InChI | InChI=1S/C14H21N3O/c1-3-13-10-17(5-4-14(13)16-18)9-12-6-11(2)7-15-8-12/h6-8,13,18H,3-5,9-10H2,1-2H3/b16-14+ |
| InChIKey | WEALMELYDFSTDK-JQIJEIRASA-N |
| XLogP | 2.45 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|