C15H20N4O — CID 114509483
(NE)-N-[3-ethyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)piperidin-4-ylidene]hydroxylamine (PubChem CID 114509483) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is (NE)-N-[3-ethyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)piperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-ethyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 114509483 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (NE)-N-[3-ethyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)piperidin-4-ylidene]hydroxylamine |
| SMILES | CCC1CN(Cc2cn3ccccc3n2)CC/C1=N\O |
| InChI | InChI=1S/C15H20N4O/c1-2-12-9-18(8-6-14(12)17-20)10-13-11-19-7-4-3-5-15(19)16-13/h3-5,7,11-12,20H,2,6,8-10H2,1H3/b17-14+ |
| InChIKey | ZBZNMFKFAXVQDQ-SAPNQHFASA-N |
| XLogP | 2.40 |
| TPSA | 53.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|