C14H20N4 — CID 64833998
2-[(3-ethylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridine (PubChem CID 64833998) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[(3-ethylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[(3-ethylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 64833998 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-[(3-ethylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridine |
| SMILES | CCC1CN(Cc2cn3ccccc3n2)CCN1 |
| InChI | InChI=1S/C14H20N4/c1-2-12-9-17(8-6-15-12)10-13-11-18-7-4-3-5-14(18)16-13/h3-5,7,11-12,15H,2,6,8-10H2,1H3 |
| InChIKey | LDJLDJMELMKLLJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |