C12H18N2O5S2 — CID 102882388
5-methoxy-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline (PubChem CID 102882388) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-methoxy-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline.
| Compound Name | 5-methoxy-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 102882388 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-methoxy-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
| SMILES | COc1ccc(S(=O)(=O)N2CCS(=O)(=O)CC2C)c(N)c1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-9-8-20(15,16)6-5-14(9)21(17,18)12-4-3-10(19-2)7-11(12)13/h3-4,7,9H,5-6,8,13H2,1-2H3 |
| InChIKey | PODJSQAJRMLZLZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|