C12H17BrN2O4S2 — CID 102882366
5-bromo-2-methyl-3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline (PubChem CID 102882366) has the molecular formula C12H17BrN2O4S2 and a molecular weight of 397.32 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline.
| Compound Name | 5-bromo-2-methyl-3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 102882366 |
| Molecular Formula | C12H17BrN2O4S2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 5-bromo-2-methyl-3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C12H17BrN2O4S2/c1-8-7-20(16,17)4-3-15(8)21(18,19)12-6-10(13)5-11(14)9(12)2/h5-6,8H,3-4,7,14H2,1-2H3 |
| InChIKey | LMISIQWLKFIREN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|