C6H13NO4S2 — CID 167985024
(3S)-3-methyl-4-methylsulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 167985024) has the molecular formula C6H13NO4S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is (3S)-3-methyl-4-methylsulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | (3S)-3-methyl-4-methylsulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 167985024 |
| Molecular Formula | C6H13NO4S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (3S)-3-methyl-4-methylsulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | C[C@H]1CS(=O)(=O)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C6H13NO4S2/c1-6-5-13(10,11)4-3-7(6)12(2,8)9/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | NBOMOGFPYVNTEA-LURJTMIESA-N |
| XLogP | -0.94 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |