C8H16ClNO4S2 — CID 102887417
4-(1-chloropropan-2-ylsulfonyl)-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 102887417) has the molecular formula C8H16ClNO4S2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 4-(1-chloropropan-2-ylsulfonyl)-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(1-chloropropan-2-ylsulfonyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 102887417 |
| Molecular Formula | C8H16ClNO4S2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-(1-chloropropan-2-ylsulfonyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1S(=O)(=O)C(C)CCl |
| InChI | InChI=1S/C8H16ClNO4S2/c1-7-6-15(11,12)4-3-10(7)16(13,14)8(2)5-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | SUGDUARNVUFKGX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|