C9H19NO5S2 — CID 102887405
4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]butan-1-ol (PubChem CID 102887405) has the molecular formula C9H19NO5S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]butan-1-ol.
| Compound Name | 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]butan-1-ol |
|---|---|
| PubChem CID | 102887405 |
| Molecular Formula | C9H19NO5S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]butan-1-ol |
| SMILES | CC1CS(=O)(=O)CCN1S(=O)(=O)CCCCO |
| InChI | InChI=1S/C9H19NO5S2/c1-9-8-16(12,13)7-4-10(9)17(14,15)6-3-2-5-11/h9,11H,2-8H2,1H3 |
| InChIKey | RPCNAZJZCGFCFL-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|