C12H16N2O4S3 — CID 102883472
4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]benzenecarbothioamide (PubChem CID 102883472) has the molecular formula C12H16N2O4S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]benzenecarbothioamide.
| Compound Name | 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102883472 |
| Molecular Formula | C12H16N2O4S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]benzenecarbothioamide |
| SMILES | CC1CS(=O)(=O)CCN1S(=O)(=O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C12H16N2O4S3/c1-9-8-20(15,16)7-6-14(9)21(17,18)11-4-2-10(3-5-11)12(13)19/h2-5,9H,6-8H2,1H3,(H2,13,19) |
| InChIKey | URRFILXDXOTQGT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|