C25H33FN2O2S — CID 10288266
(1S,3aS,5aR,9aS,11aS)-8-fluoro-6,9a,11a-trimethyl-7-oxo-N-(thiophen-3-ylmethyl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide (PubChem CID 10288266) has the molecular formula C25H33FN2O2S and a molecular weight of 444.62 g/mol. Its IUPAC name is (1S,3aS,5aR,9aS,11aS)-8-fluoro-6,9a,11a-trimethyl-7-oxo-N-(thiophen-3-ylmethyl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (1S,3aS,5aR,9aS,11aS)-8-fluoro-6,9a,11a-trimethyl-7-oxo-N-(thiophen-3-ylmethyl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 10288266 |
| Molecular Formula | C25H33FN2O2S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (1S,3aS,5aR,9aS,11aS)-8-fluoro-6,9a,11a-trimethyl-7-oxo-N-(thiophen-3-ylmethyl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
| SMILES | CN1C(=O)C(F)=C[C@]2(C)C3CC[C@]4(C)[C@@H](C(=O)NCc5ccsc5)CC[C@H]4C3CC[C@@H]12 |
| InChI | InChI=1S/C25H33FN2O2S/c1-24-10-8-18-16(4-7-21-25(18,2)12-20(26)23(30)28(21)3)17(24)5-6-19(24)22(29)27-13-15-9-11-31-14-15/h9,11-12,14,16-19,21H,4-8,10,13H2,1-3H3,(H,27,29)/t16?,17-,18?,19+,21+,24-,25+/m0/s1 |
| InChIKey | AQDGATUSWHPALW-ZWKZYIPLSA-N |
| XLogP | 4.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |