C12H15FN2O3S — CID 102883333
(2-amino-3-fluorophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 102883333) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is (2-amino-3-fluorophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2-amino-3-fluorophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 102883333 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2-amino-3-fluorophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)c1cccc(F)c1N |
| InChI | InChI=1S/C12H15FN2O3S/c1-8-7-19(17,18)6-5-15(8)12(16)9-3-2-4-10(13)11(9)14/h2-4,8H,5-7,14H2,1H3 |
| InChIKey | OOURDTNITVPLTD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|