C9H8FN3OS — CID 102885475
5-(2-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-3-amine (PubChem CID 102885475) has the molecular formula C9H8FN3OS and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-(2-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(2-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 102885475 |
| Molecular Formula | C9H8FN3OS |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 5-(2-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-3-amine |
| SMILES | COc1ccc(-c2nc(N)ns2)c(F)c1 |
| InChI | InChI=1S/C9H8FN3OS/c1-14-5-2-3-6(7(10)4-5)8-12-9(11)13-15-8/h2-4H,1H3,(H2,11,13) |
| InChIKey | GMEGRRSKBUCBCL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |