C12H13FN2OS — CID 81309552
2-[2-(2-fluoro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 81309552) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-(2-fluoro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 2-[2-(2-fluoro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 81309552 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[2-(2-fluoro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | COc1ccc(-c2nc(CCN)cs2)c(F)c1 |
| InChI | InChI=1S/C12H13FN2OS/c1-16-9-2-3-10(11(13)6-9)12-15-8(4-5-14)7-17-12/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | BWLIFXTVNXMLRC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |