About [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine
[3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine (PubChem CID 102886834) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine |
| PubChem CID | 102886834 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine |
| SMILES | CC1CS(=O)(=O)CCN1Cc1c(CN)oc2ccccc12 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-10-21(18,19)7-6-17(11)9-13-12-4-2-3-5-14(12)20-15(13)8-16/h2-5,11H,6-10,16H2,1H3 |
| InChIKey | YAOJBQQXUKMIHR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine?
The IUPAC name of [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine (CID 102886834) is [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine.
What is the SMILES notation for [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine?
The canonical SMILES for [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine is CC1CS(=O)(=O)CCN1Cc1c(CN)oc2ccccc12.
What is the InChIKey of [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine?
The InChIKey is YAOJBQQXUKMIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-11-10-21(18,19)7-6-17(11)9-13-12-4-2-3-5-14(12)20-15(13)8-16/h2-5,11H,6-10,16H2,1H3.
What are the key properties of [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine?
[3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine has a molecular weight of 308.40 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-benzofuran-2-yl]methanamine is sourced from PubChem (CID 102886834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).