C10H14N4O2 — CID 102888065
1-methyl-4-(6-oxo-1H-pyridazin-4-yl)-1,4-diazepan-2-one (PubChem CID 102888065) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-methyl-4-(6-oxo-1H-pyridazin-4-yl)-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-(6-oxo-1H-pyridazin-4-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888065 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-methyl-4-(6-oxo-1H-pyridazin-4-yl)-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2cn[nH]c(=O)c2)CC1=O |
| InChI | InChI=1S/C10H14N4O2/c1-13-3-2-4-14(7-10(13)16)8-5-9(15)12-11-6-8/h5-6H,2-4,7H2,1H3,(H,12,15) |
| InChIKey | CARLBILAKUYGGB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |