C10H16N4O — CID 54775420
4-(4-methyl-1,4-diazepan-1-yl)-1H-pyridazin-6-one (PubChem CID 54775420) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-1-yl)-1H-pyridazin-6-one.
| Compound Name | 4-(4-methyl-1,4-diazepan-1-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 54775420 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-1-yl)-1H-pyridazin-6-one |
| SMILES | CN1CCCN(c2cn[nH]c(=O)c2)CC1 |
| InChI | InChI=1S/C10H16N4O/c1-13-3-2-4-14(6-5-13)9-7-10(15)12-11-8-9/h7-8H,2-6H2,1H3,(H,12,15) |
| InChIKey | IWQPUKSWAWGAPZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |