About 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid
2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid (PubChem CID 102889475) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid |
| PubChem CID | 102889475 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C10H18N2O3/c1-3-8(10(14)15)12-6-4-5-11(2)9(13)7-12/h8H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | RSDXZWYFOYLYRO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid?
The IUPAC name of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid (CID 102889475) is 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid.
What is the SMILES notation for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid?
The canonical SMILES for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid is CCC(C(=O)O)N1CCCN(C)C(=O)C1.
What is the InChIKey of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid?
The InChIKey is RSDXZWYFOYLYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-3-8(10(14)15)12-6-4-5-11(2)9(13)7-12/h8H,3-7H2,1-2H3,(H,14,15).
What are the key properties of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid?
2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid has a molecular weight of 214.26 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)butanoic acid is sourced from PubChem (CID 102889475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).