C14H21NO5S — CID 102890557
2-(1,1-dioxothiane-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102890557) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-(1,1-dioxothiane-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(1,1-dioxothiane-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102890557 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(1,1-dioxothiane-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H21NO5S/c16-13(11-6-1-2-7-21(11,19)20)15-8-9-4-3-5-10(9)12(15)14(17)18/h9-12H,1-8H2,(H,17,18) |
| InChIKey | PNTOJQARIZGOGQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |