C15H23F3N2O — CID 102891272
N-[3-(trifluoromethyl)cyclohexyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102891272) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)cyclohexyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-[3-(trifluoromethyl)cyclohexyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102891272 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[3-(trifluoromethyl)cyclohexyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(NC1CCCC(C(F)(F)F)C1)C1NCC2CCCC21 |
| InChI | InChI=1S/C15H23F3N2O/c16-15(17,18)10-4-2-5-11(7-10)20-14(21)13-12-6-1-3-9(12)8-19-13/h9-13,19H,1-8H2,(H,20,21) |
| InChIKey | AIBNHGWOHDCXDI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |