C13H20N2O3 — CID 102892250
(2S)-1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 102892250) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S)-1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102892250 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C13H20N2O3/c16-12(15-6-2-5-10(15)13(17)18)11-9-4-1-3-8(9)7-14-11/h8-11,14H,1-7H2,(H,17,18)/t8?,9?,10-,11?/m0/s1 |
| InChIKey | PJFVIJSPJLTJLD-MWJCJQSMSA-N |
| XLogP | 0.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |